


perl-SNMP-Info - Object Oriented Perl5 Interface to Network devices and MIBs through SNMP

Property Value
Distribution Mageia 7.1
Repository Mageia Core x86_64
Package filename perl-SNMP-Info-3.670.0-1.mga7.noarch.rpm
Package name perl-SNMP-Info
Package version 3.670.0
Package release 1.mga7
Package architecture noarch
Package type rpm
Category Development/Perl
License BSD-like
Maintainer -
Download size 535.47 KB
Installed size 2.19 MB
SNMP::Info gives an object oriented interface to information obtained
through SNMP.
This module lives at Check for newest
version and documentation.
This module is geared towards network devices. Subclasses exist for a
number of network devices and common MIBs.
The idea behind this module is to give a common interface to data from
network devices, leaving the device-specific hacks behind the scenes in
In the SYNOPSIS example we fetch the name of all the ports on the device
and the duplex setting for that port with two methods -- interfaces()
and i_duplex().
The information may be coming from any number of MIB files and is very
vendor specific. SNMP::Info provides you a common method for all
supported devices.
Adding support for your own device is easy, and takes little much SNMP
The module is not limited to network devices. Any MIB or device can be
given an objected oriented front-end by making a module that consists of
a couple hashes. See EXTENDING SNMP::INFO.


Package Version Architecture Repository
perl-SNMP-Info-3.670.0-1.mga7.noarch.rpm 3.670.0 noarch Mageia Core
perl-SNMP-Info - - -


Name Value
perl(Carp) -
perl(Class::ISA) -
perl(Data::Dumper) -
perl(Exporter) -
perl(Math::BigInt) -
perl(Module::Info) -
perl(Module::Load) -
perl(NetAddr::IP) >= 4.68.0
perl(NetAddr::IP::Lite) -
perl(PPI) -
perl(SNMP) -
perl(SNMP::Info) -
perl(SNMP::Info::AMAP) -
perl(SNMP::Info::AdslLine) -
perl(SNMP::Info::Aggregate) -
perl(SNMP::Info::Airespace) -
perl(SNMP::Info::Bridge) -
perl(SNMP::Info::CDP) -
perl(SNMP::Info::CiscoAgg) -
perl(SNMP::Info::CiscoConfig) -
perl(SNMP::Info::CiscoPortSecurity) -
perl(SNMP::Info::CiscoPower) -
perl(SNMP::Info::CiscoQOS) -
perl(SNMP::Info::CiscoRTT) -
perl(SNMP::Info::CiscoStack) -
perl(SNMP::Info::CiscoStats) -
perl(SNMP::Info::CiscoStpExtensions) -
perl(SNMP::Info::CiscoVTP) -
perl(SNMP::Info::DocsisHE) -
perl(SNMP::Info::EDP) -
perl(SNMP::Info::Entity) -
perl(SNMP::Info::EtherLike) -
perl(SNMP::Info::FDP) -
perl(SNMP::Info::IEEE802dot11) -
perl(SNMP::Info::IEEE802dot3ad) -
perl(SNMP::Info::IPv6) -
perl(SNMP::Info::LLDP) -
perl(SNMP::Info::Layer1) -
perl(SNMP::Info::Layer2) -
perl(SNMP::Info::Layer2::Cisco) -
perl(SNMP::Info::Layer3) -
perl(SNMP::Info::Layer3::Cisco) -
perl(SNMP::Info::Layer3::CiscoSwitch) -
perl(SNMP::Info::Layer7) -
perl(SNMP::Info::MAU) -
perl(SNMP::Info::NortelStack) -
perl(SNMP::Info::PowerEthernet) -
perl(SNMP::Info::RapidCity) -
perl(SNMP::Info::SONMP) -
perl(constant) -
perl(strict) -
perl(warnings) -
perl-base >= 5.28.1


Name Value
perl(SNMP::Info) = 3.670.0
perl(SNMP::Info::AMAP) = 3.670.0
perl(SNMP::Info::AdslLine) = 3.670.0
perl(SNMP::Info::Aggregate) = 3.670.0
perl(SNMP::Info::Airespace) = 3.670.0
perl(SNMP::Info::Bridge) = 3.670.0
perl(SNMP::Info::CDP) = 3.670.0
perl(SNMP::Info::CiscoAgg) = 3.670.0
perl(SNMP::Info::CiscoConfig) = 3.670.0
perl(SNMP::Info::CiscoPortSecurity) = 3.670.0
perl(SNMP::Info::CiscoPower) = 3.670.0
perl(SNMP::Info::CiscoQOS) = 3.670.0
perl(SNMP::Info::CiscoRTT) = 3.670.0
perl(SNMP::Info::CiscoStack) = 3.670.0
perl(SNMP::Info::CiscoStats) = 3.670.0
perl(SNMP::Info::CiscoStpExtensions) = 3.670.0
perl(SNMP::Info::CiscoVTP) = 3.670.0
perl(SNMP::Info::DocsisHE) = 3.670.0
perl(SNMP::Info::EDP) = 3.670.0
perl(SNMP::Info::Entity) = 3.670.0
perl(SNMP::Info::EtherLike) = 3.670.0
perl(SNMP::Info::FDP) = 3.670.0
perl(SNMP::Info::IEEE802dot11) = 3.670.0
perl(SNMP::Info::IEEE802dot3ad) = 3.670.0
perl(SNMP::Info::IPv6) = 3.670.0
perl(SNMP::Info::LLDP) = 3.670.0
perl(SNMP::Info::Layer1) = 3.670.0
perl(SNMP::Info::Layer1::Allied) = 3.670.0
perl(SNMP::Info::Layer1::Asante) = 3.670.0
perl(SNMP::Info::Layer1::Bayhub) = 3.670.0
perl(SNMP::Info::Layer1::Cyclades) = 3.670.0
perl(SNMP::Info::Layer1::S3000) = 3.670.0
perl(SNMP::Info::Layer2) = 3.670.0
perl(SNMP::Info::Layer2::3Com) = 3.670.0
perl(SNMP::Info::Layer2::Adtran) = 3.670.0
perl(SNMP::Info::Layer2::Aerohive) = 3.670.0
perl(SNMP::Info::Layer2::Airespace) = 3.670.0
perl(SNMP::Info::Layer2::Aironet) = 3.670.0
perl(SNMP::Info::Layer2::Allied) = 3.670.0
perl(SNMP::Info::Layer2::Atmedia) = 3.670.0
perl(SNMP::Info::Layer2::Baystack) = 3.670.0
perl(SNMP::Info::Layer2::C1900) = 3.670.0
perl(SNMP::Info::Layer2::C2900) = 3.670.0
perl(SNMP::Info::Layer2::Catalyst) = 3.670.0
perl(SNMP::Info::Layer2::Centillion) = 3.670.0
perl(SNMP::Info::Layer2::Cisco) = 3.670.0
perl(SNMP::Info::Layer2::CiscoSB) = 3.670.0
perl(SNMP::Info::Layer2::Exinda) = 3.670.0
perl(SNMP::Info::Layer2::HP) = 3.670.0
perl(SNMP::Info::Layer2::HP4000) = 3.670.0
perl(SNMP::Info::Layer2::HPVC) = 3.670.0
perl(SNMP::Info::Layer2::Kentrox) = 3.670.0
perl(SNMP::Info::Layer2::N2270) = 3.670.0
perl(SNMP::Info::Layer2::NAP222x) = 3.670.0
perl(SNMP::Info::Layer2::NWSS2300) = 3.670.0
perl(SNMP::Info::Layer2::Netgear) = 3.670.0
perl(SNMP::Info::Layer2::Nexans) = 3.670.0
perl(SNMP::Info::Layer2::Orinoco) = 3.670.0
perl(SNMP::Info::Layer2::Sixnet) = 3.670.0
perl(SNMP::Info::Layer2::Trapeze) = 3.670.0
perl(SNMP::Info::Layer2::Ubiquiti) = 3.670.0
perl(SNMP::Info::Layer2::ZyXEL_DSLAM) = 3.670.0
perl(SNMP::Info::Layer3) = 3.670.0
perl(SNMP::Info::Layer3::Aironet) = 3.670.0
perl(SNMP::Info::Layer3::AlcatelLucent) = 3.670.0
perl(SNMP::Info::Layer3::AlteonAD) = 3.670.0
perl(SNMP::Info::Layer3::Altiga) = 3.670.0
perl(SNMP::Info::Layer3::Arista) = 3.670.0
perl(SNMP::Info::Layer3::Aruba) = 3.670.0
perl(SNMP::Info::Layer3::BayRS) = 3.670.0
perl(SNMP::Info::Layer3::BlueCoatSG) = 3.670.0
perl(SNMP::Info::Layer3::C3550) = 3.670.0
perl(SNMP::Info::Layer3::C4000) = 3.670.0
perl(SNMP::Info::Layer3::C6500) = 3.670.0
perl(SNMP::Info::Layer3::CheckPoint) = 3.670.0
perl(SNMP::Info::Layer3::Cisco) = 3.670.0
perl(SNMP::Info::Layer3::CiscoASA) = 3.670.0
perl(SNMP::Info::Layer3::CiscoFWSM) = 3.670.0
perl(SNMP::Info::Layer3::CiscoSwitch) = 3.670.0
perl(SNMP::Info::Layer3::Contivity) = 3.670.0
perl(SNMP::Info::Layer3::Cumulus) = 3.670.0
perl(SNMP::Info::Layer3::DLink) = 3.670.0
perl(SNMP::Info::Layer3::Dell) = 3.670.0
perl(SNMP::Info::Layer3::ERX) = 3.670.0
perl(SNMP::Info::Layer3::Enterasys) = 3.670.0
perl(SNMP::Info::Layer3::Extreme) = 3.670.0
perl(SNMP::Info::Layer3::F5) = 3.670.0
perl(SNMP::Info::Layer3::Force10) = 3.670.0
perl(SNMP::Info::Layer3::Fortinet) = 3.670.0
perl(SNMP::Info::Layer3::Foundry) = 3.670.0
perl(SNMP::Info::Layer3::Genua) = 3.670.0
perl(SNMP::Info::Layer3::H3C) = 3.670.0
perl(SNMP::Info::Layer3::HP9300) = 3.670.0
perl(SNMP::Info::Layer3::Huawei) = 3.670.0
perl(SNMP::Info::Layer3::IBMGbTor) = 3.670.0
perl(SNMP::Info::Layer3::Juniper) = 3.670.0
perl(SNMP::Info::Layer3::Lantronix) = 3.670.0
perl(SNMP::Info::Layer3::Lenovo) = 3.670.0
perl(SNMP::Info::Layer3::Microsoft) = 3.670.0
perl(SNMP::Info::Layer3::Mikrotik) = 3.670.0
perl(SNMP::Info::Layer3::N1600) = 3.670.0
perl(SNMP::Info::Layer3::NetSNMP) = 3.670.0
perl(SNMP::Info::Layer3::Netscreen) = 3.670.0
perl(SNMP::Info::Layer3::Nexus) = 3.670.0
perl(SNMP::Info::Layer3::OneAccess) = 3.670.0
perl(SNMP::Info::Layer3::PacketFront) = 3.670.0
perl(SNMP::Info::Layer3::PaloAlto) = 3.670.0
perl(SNMP::Info::Layer3::Passport) = 3.670.0
perl(SNMP::Info::Layer3::Pf) = 3.670.0
perl(SNMP::Info::Layer3::Pica8) = 3.670.0
perl(SNMP::Info::Layer3::SonicWALL) = 3.670.0
perl(SNMP::Info::Layer3::Steelhead) = 3.670.0
perl(SNMP::Info::Layer3::Sun) = 3.670.0
perl(SNMP::Info::Layer3::Tasman) = 3.670.0
perl(SNMP::Info::Layer3::Timetra) = 3.670.0
perl(SNMP::Info::Layer3::VMware) = 3.670.0
perl(SNMP::Info::Layer3::VyOS) = 3.670.0
perl(SNMP::Info::Layer7) = 3.670.0
perl(SNMP::Info::Layer7::APC) = 3.670.0
perl(SNMP::Info::Layer7::Arbor) = 3.670.0
perl(SNMP::Info::Layer7::CiscoIPS) = 3.670.0
perl(SNMP::Info::Layer7::Gigamon) = 3.670.0
perl(SNMP::Info::Layer7::Liebert) = 3.670.0
perl(SNMP::Info::Layer7::Neoteris) = 3.670.0
perl(SNMP::Info::Layer7::Netscaler) = 3.670.0
perl(SNMP::Info::MAU) = 3.670.0
perl(SNMP::Info::MRO) = 3.670.0
perl(SNMP::Info::NortelStack) = 3.670.0
perl(SNMP::Info::PowerEthernet) = 3.670.0
perl(SNMP::Info::RapidCity) = 3.670.0
perl(SNMP::Info::SONMP) = 3.670.0
perl-SNMP-Info = 3.670.0-1.mga7


Type URL
Binary Package perl-SNMP-Info-3.670.0-1.mga7.noarch.rpm
Source Package perl-SNMP-Info-3.670.0-1.mga7.src.rpm

Install Howto

  1. Enable the repository in Software Management
  2. Install perl-SNMP-Info rpm package:
    # dnf install perl-SNMP-Info




2019-04-21 - shlomif <shlomif> 3.670.0-1.mga7
+ Revision: 1394452
- update to 3.67
2019-03-24 - tv <tv> 3.660.0-1.mga7
+ Revision: 1380033
- update to 3.66
2019-03-15 - tv <tv> 3.650.0-1.mga7
+ Revision: 1377512
- update to 3.65
2018-12-30 - tv <tv> 3.640.0-1.mga7
+ Revision: 1347003
- new release
2018-11-29 - tv <tv> 3.630.0-1.mga7
+ Revision: 1336684
- update to 3.63
2018-09-20 - umeabot <umeabot> 3.520.0-2.mga7
+ Revision: 1285964
- Mageia 7 Mass Rebuild
2018-03-20 - shlomif <shlomif> 3.520.0-1.mga7
+ Revision: 1210694
- New version 3.52
2017-12-26 - shlomif <shlomif> 3.390.0-1.mga7
+ Revision: 1185330
- update to 3.39
2017-10-24 - shlomif <shlomif> 3.380.0-1.mga7
+ Revision: 1173375
- update to 3.38
2017-10-03 - tv <tv> 3.370.0-2.mga7
+ Revision: 1166530
- rebuild with fixed rpm for missing autodeps

See Also

Package Description
perl-SNMP-MIB-Compiler-0.60.0-8.mga7.noarch.rpm A MIB Compiler for perl
perl-SNMP-Map-1.10.0-8.mga7.noarch.rpm Tool for drawing network map
perl-SNMP_Session-1.13-8.mga7.noarch.rpm SNMP support for Perl 5
perl-SOAP-Lite-1.270.0-1.mga7.noarch.rpm Client and server side SOAP implementation
perl-SOAP-Lite-SmartProxy-0.110.0-8.mga7.noarch.rpm SOAP::Transport::HTTPX Server/Client side HTTP Smart Proxy for SOAP::Lite
perl-SOAP-Transport-FTP-0.711.0-9.mga7.noarch.rpm MQ support for SOAP::Lite
perl-SOAP-Transport-JABBER-0.713.0-9.mga7.noarch.rpm JABBER support for SOAP::Lite
perl-SOAP-WSDL-3.3.0-4.mga7.noarch.rpm SOAP with WSDL support
perl-SOAP-payload-1.20.0-8.mga7.noarch.rpm SOAP::payload - Perl module to send various forms of information as SOAP envelopes
perl-SQ-0.0.5-3.mga7.noarch.rpm Easily have a string containing single quote (') from the command line
perl-SQL-Abstract-1.860.0-2.mga7.noarch.rpm Generate SQL from Perl data structures
perl-SQL-Abstract-Limit-0.141.0-11.mga7.noarch.rpm Portable LIMIT emulation
perl-SQL-Abstract-More-1.330.0-2.mga7.noarch.rpm Extension of SQL::Abstract with more constructs and more flexible API
perl-SQL-Maker-1.210.0-4.mga7.noarch.rpm Insert multiple rows at once on MySQL
perl-SQL-QueryMaker-0.30.0-8.mga7.noarch.rpm Helper functions for SQL query generation